C8HF16N — CID 54159724
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2,3,3-hexafluoropropyl)piperidine (PubChem CID 54159724) has the molecular formula C8HF16N and a molecular weight of 415.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2,3,3-hexafluoropropyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2,3,3-hexafluoropropyl)piperidine |
|---|---|
| PubChem CID | 54159724 |
| Molecular Formula | C8HF16N |
| Molecular Weight | 415.07 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2,3,3-hexafluoropropyl)piperidine |
| SMILES | FC(F)C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8HF16N/c9-1(10)2(11,12)6(19,20)25-7(21,22)4(15,16)3(13,14)5(17,18)8(25,23)24/h1H |
| InChIKey | IOYXRNBOFGZMOV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.07 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|