About 2-chloroethenyl dipropan-2-yl phosphate
2-chloroethenyl dipropan-2-yl phosphate (PubChem CID 54160652) has the molecular formula C8H16ClO4P
and a molecular weight of 242.64 g/mol. Its IUPAC name is 2-chloroethenyl dipropan-2-yl phosphate.
Molecular Properties
| Compound Name | 2-chloroethenyl dipropan-2-yl phosphate |
| PubChem CID | 54160652 |
| Molecular Formula | C8H16ClO4P |
| Molecular Weight | 242.64 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-chloroethenyl dipropan-2-yl phosphate |
| SMILES | CC(C)OP(=O)(OC=CCl)OC(C)C |
| InChI | InChI=1S/C8H16ClO4P/c1-7(2)12-14(10,11-6-5-9)13-8(3)4/h5-8H,1-4H3 |
| InChIKey | OODYAWXVNBHCNF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethenyl dipropan-2-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethenyl dipropan-2-yl phosphate?
The IUPAC name of 2-chloroethenyl dipropan-2-yl phosphate (CID 54160652) is 2-chloroethenyl dipropan-2-yl phosphate.
What is the SMILES notation for 2-chloroethenyl dipropan-2-yl phosphate?
The canonical SMILES for 2-chloroethenyl dipropan-2-yl phosphate is CC(C)OP(=O)(OC=CCl)OC(C)C.
What is the InChIKey of 2-chloroethenyl dipropan-2-yl phosphate?
The InChIKey is OODYAWXVNBHCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16ClO4P/c1-7(2)12-14(10,11-6-5-9)13-8(3)4/h5-8H,1-4H3.
What are the key properties of 2-chloroethenyl dipropan-2-yl phosphate?
2-chloroethenyl dipropan-2-yl phosphate has a molecular weight of 242.64 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethenyl dipropan-2-yl phosphate is sourced from PubChem (CID 54160652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).