C13H10ClN7O — CID 54160815
14-chloro-N'-hydroxy-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboximidamide (PubChem CID 54160815) has the molecular formula C13H10ClN7O and a molecular weight of 315.72 g/mol. Its IUPAC name is 14-chloro-N'-hydroxy-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboximidamide.
| Compound Name | 14-chloro-N'-hydroxy-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboximidamide |
|---|---|
| PubChem CID | 54160815 |
| Molecular Formula | C13H10ClN7O |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 14-chloro-N'-hydroxy-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboximidamide |
| SMILES | NC(=NO)c1ncn2c1Cn1ncnc1-c1c(Cl)cccc1-2 |
| InChI | InChI=1S/C13H10ClN7O/c14-7-2-1-3-8-10(7)13-16-5-18-21(13)4-9-11(12(15)19-22)17-6-20(8)9/h1-3,5-6,22H,4H2,(H2,15,19) |
| InChIKey | OOGSRLXLHVPTGE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 107.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|