C9H8F5NO — CID 54161023
N-(1,1,2,2,3-pentafluoropropoxy)aniline (PubChem CID 54161023) has the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. Its IUPAC name is N-(1,1,2,2,3-pentafluoropropoxy)aniline.
| Compound Name | N-(1,1,2,2,3-pentafluoropropoxy)aniline |
|---|---|
| PubChem CID | 54161023 |
| Molecular Formula | C9H8F5NO |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-(1,1,2,2,3-pentafluoropropoxy)aniline |
| SMILES | FCC(F)(F)C(F)(F)ONc1ccccc1 |
| InChI | InChI=1S/C9H8F5NO/c10-6-8(11,12)9(13,14)16-15-7-4-2-1-3-5-7/h1-5,15H,6H2 |
| InChIKey | OOKGOVNGJAIERH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|