C15H19BrO — CID 54162111
1-(8-bromoocta-1,5-dienyl)-4-methoxybenzene (PubChem CID 54162111) has the molecular formula C15H19BrO and a molecular weight of 295.22 g/mol. Its IUPAC name is 1-(8-bromoocta-1,5-dienyl)-4-methoxybenzene.
| Compound Name | 1-(8-bromoocta-1,5-dienyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 54162111 |
| Molecular Formula | C15H19BrO |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-(8-bromoocta-1,5-dienyl)-4-methoxybenzene |
| SMILES | COc1ccc(C=CCCC=CCCBr)cc1 |
| InChI | InChI=1S/C15H19BrO/c1-17-15-11-9-14(10-12-15)8-6-4-2-3-5-7-13-16/h3,5-6,8-12H,2,4,7,13H2,1H3 |
| InChIKey | OPDHWTHFBPLUOL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|