About [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol
[(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol (PubChem CID 54162215) has the molecular formula C13H16BrClO3
and a molecular weight of 335.63 g/mol. Its IUPAC name is [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 54162215 |
| Molecular Formula | C13H16BrClO3 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol |
| SMILES | OC[C@@H]1CO[C@](CBr)(CCc2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C13H16BrClO3/c14-9-13(17-8-12(7-16)18-13)6-5-10-1-3-11(15)4-2-10/h1-4,12,16H,5-9H2/t12-,13-/m1/s1 |
| InChIKey | OPFNPMHDICMZMQ-CHWSQXEVSA-N |
| XLogP | 2.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol (CID 54162215) is [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol is OC[C@@H]1CO[C@](CBr)(CCc2ccc(Cl)cc2)O1.
What is the InChIKey of [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol?
The InChIKey is OPFNPMHDICMZMQ-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H16BrClO3/c14-9-13(17-8-12(7-16)18-13)6-5-10-1-3-11(15)4-2-10/h1-4,12,16H,5-9H2/t12-,13-/m1/s1.
What are the key properties of [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol?
[(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol has a molecular weight of 335.63 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4R)-2-(bromomethyl)-2-[2-(4-chlorophenyl)ethyl]-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 54162215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).