C30H33ClN4O6 — CID 54162331
N-(2-chloro-3,4-dimethoxyphenyl)-N-[[1-[(2-methoxy-3-nitrophenyl)methyl]benzimidazol-2-yl]methyl]-4-methylpentanamide (PubChem CID 54162331) has the molecular formula C30H33ClN4O6 and a molecular weight of 581.07 g/mol. Its IUPAC name is N-(2-chloro-3,4-dimethoxyphenyl)-N-[[1-[(2-methoxy-3-nitrophenyl)methyl]benzimidazol-2-yl]methyl]-4-methylpentanamide.
| Compound Name | N-(2-chloro-3,4-dimethoxyphenyl)-N-[[1-[(2-methoxy-3-nitrophenyl)methyl]benzimidazol-2-yl]methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 54162331 |
| Molecular Formula | C30H33ClN4O6 |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | N-(2-chloro-3,4-dimethoxyphenyl)-N-[[1-[(2-methoxy-3-nitrophenyl)methyl]benzimidazol-2-yl]methyl]-4-methylpentanamide |
| SMILES | COc1ccc(N(Cc2nc3ccccc3n2Cc2cccc([N+](=O)[O-])c2OC)C(=O)CCC(C)C)c(Cl)c1OC |
| InChI | InChI=1S/C30H33ClN4O6/c1-19(2)13-16-27(36)34(23-14-15-25(39-3)30(41-5)28(23)31)18-26-32-21-10-6-7-11-22(21)33(26)17-20-9-8-12-24(35(37)38)29(20)40-4/h6-12,14-15,19H,13,16-18H2,1-5H3 |
| InChIKey | OPHOWCOGYDWJAT-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 108.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|