C30H34N2O — CID 54162462
N-[4-[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]butyl]-4-phenylbenzamide (PubChem CID 54162462) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is N-[4-[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]butyl]-4-phenylbenzamide.
| Compound Name | N-[4-[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 54162462 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N-[4-[(4aR,10bS)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]butyl]-4-phenylbenzamide |
| SMILES | O=C(NCCCCN1CCC[C@H]2c3ccccc3CC[C@H]21)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H34N2O/c33-30(26-16-14-24(15-17-26)23-9-2-1-3-10-23)31-20-6-7-21-32-22-8-13-28-27-12-5-4-11-25(27)18-19-29(28)32/h1-5,9-12,14-17,28-29H,6-8,13,18-22H2,(H,31,33)/t28-,29+/m0/s1 |
| InChIKey | OPJTVMKUVYOWNC-URLMMPGGSA-N |
| XLogP | 6.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|