About (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine
(NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine (PubChem CID 5416282) has the molecular formula C13H13N3O4
and a molecular weight of 275.26 g/mol. Its IUPAC name is (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine |
| PubChem CID | 5416282 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine |
| SMILES | COc1cc(OC)nc(Oc2ccccc2/C=N/O)n1 |
| InChI | InChI=1S/C13H13N3O4/c1-18-11-7-12(19-2)16-13(15-11)20-10-6-4-3-5-9(10)8-14-17/h3-8,17H,1-2H3/b14-8+ |
| InChIKey | LOGUXYNNYUMCAE-RIYZIHGNSA-N |
| XLogP | 2.09 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine?
The IUPAC name of (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine (CID 5416282) is (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine is COc1cc(OC)nc(Oc2ccccc2/C=N/O)n1.
What is the InChIKey of (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine?
The InChIKey is LOGUXYNNYUMCAE-RIYZIHGNSA-N. The full InChI is InChI=1S/C13H13N3O4/c1-18-11-7-12(19-2)16-13(15-11)20-10-6-4-3-5-9(10)8-14-17/h3-8,17H,1-2H3/b14-8+.
What are the key properties of (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine?
(NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine has a molecular weight of 275.26 g/mol, XLogP of 2.09, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylidene]hydroxylamine is sourced from PubChem (CID 5416282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).