About 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane
1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane (PubChem CID 54163194) has the molecular formula C23H40F2
and a molecular weight of 354.57 g/mol. Its IUPAC name is 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane.
Molecular Properties
| Compound Name | 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane |
| PubChem CID | 54163194 |
| Molecular Formula | C23H40F2 |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane |
| SMILES | CCCCCC1CCC(C(F)=C(F)C2CCC(CCCC)CC2)CC1 |
| InChI | InChI=1S/C23H40F2/c1-3-5-7-9-19-12-16-21(17-13-19)23(25)22(24)20-14-10-18(11-15-20)8-6-4-2/h18-21H,3-17H2,1-2H3 |
| InChIKey | OPVSADPGWNBBJH-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane?
The IUPAC name of 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane (CID 54163194) is 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane.
What is the SMILES notation for 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane?
The canonical SMILES for 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane is CCCCCC1CCC(C(F)=C(F)C2CCC(CCCC)CC2)CC1.
What is the InChIKey of 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane?
The InChIKey is OPVSADPGWNBBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40F2/c1-3-5-7-9-19-12-16-21(17-13-19)23(25)22(24)20-14-10-18(11-15-20)8-6-4-2/h18-21H,3-17H2,1-2H3.
What are the key properties of 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane?
1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane has a molecular weight of 354.57 g/mol, XLogP of 8.52, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-[1,2-difluoro-2-(4-pentylcyclohexyl)ethenyl]cyclohexane is sourced from PubChem (CID 54163194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).