C12H12Cl2N4 — CID 54163261
6,6-dichloro-4-phenyldiazenylcyclohexa-2,4-diene-1,1-diamine (PubChem CID 54163261) has the molecular formula C12H12Cl2N4 and a molecular weight of 283.16 g/mol. Its IUPAC name is 6,6-dichloro-4-phenyldiazenylcyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 6,6-dichloro-4-phenyldiazenylcyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 54163261 |
| Molecular Formula | C12H12Cl2N4 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 6,6-dichloro-4-phenyldiazenylcyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(/N=N/c2ccccc2)=CC1(Cl)Cl |
| InChI | InChI=1S/C12H12Cl2N4/c13-11(14)8-10(6-7-12(11,15)16)18-17-9-4-2-1-3-5-9/h1-8H,15-16H2/b18-17+ |
| InChIKey | OPWXMUBNKDHDAC-ISLYRVAYSA-N |
| XLogP | 3.01 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|