About 3-(hydroxymethyl)pent-2-ene-1,5-diol
3-(hydroxymethyl)pent-2-ene-1,5-diol (PubChem CID 54163262) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-(hydroxymethyl)pent-2-ene-1,5-diol.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)pent-2-ene-1,5-diol |
| PubChem CID | 54163262 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 3-(hydroxymethyl)pent-2-ene-1,5-diol |
| SMILES | OCC=C(CO)CCO |
| InChI | InChI=1S/C6H12O3/c7-3-1-6(5-9)2-4-8/h1,7-9H,2-5H2 |
| InChIKey | OPWXOSDGXNFVNM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydroxymethyl)pent-2-ene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)pent-2-ene-1,5-diol?
The IUPAC name of 3-(hydroxymethyl)pent-2-ene-1,5-diol (CID 54163262) is 3-(hydroxymethyl)pent-2-ene-1,5-diol.
What is the SMILES notation for 3-(hydroxymethyl)pent-2-ene-1,5-diol?
The canonical SMILES for 3-(hydroxymethyl)pent-2-ene-1,5-diol is OCC=C(CO)CCO.
What is the InChIKey of 3-(hydroxymethyl)pent-2-ene-1,5-diol?
The InChIKey is OPWXOSDGXNFVNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3/c7-3-1-6(5-9)2-4-8/h1,7-9H,2-5H2.
What are the key properties of 3-(hydroxymethyl)pent-2-ene-1,5-diol?
3-(hydroxymethyl)pent-2-ene-1,5-diol has a molecular weight of 132.16 g/mol, XLogP of -0.72, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)pent-2-ene-1,5-diol is sourced from PubChem (CID 54163262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).