About 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione
7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione (PubChem CID 54163688) has the molecular formula C7H5NS
and a molecular weight of 135.19 g/mol. Its IUPAC name is 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione.
Molecular Properties
| Compound Name | 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione |
| PubChem CID | 54163688 |
| Molecular Formula | C7H5NS |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione |
| SMILES | S=C1Nc2ccccc21 |
| InChI | InChI=1S/C7H5NS/c9-7-5-3-1-2-4-6(5)8-7/h1-4H,(H,8,9) |
| InChIKey | OQEHPFYRSNGBTQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione?
The IUPAC name of 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione (CID 54163688) is 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione.
What is the SMILES notation for 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione?
The canonical SMILES for 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione is S=C1Nc2ccccc21.
What is the InChIKey of 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione?
The InChIKey is OQEHPFYRSNGBTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS/c9-7-5-3-1-2-4-6(5)8-7/h1-4H,(H,8,9).
What are the key properties of 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione?
7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione has a molecular weight of 135.19 g/mol, XLogP of 1.79, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azabicyclo[4.2.0]octa-1,3,5-triene-8-thione is sourced from PubChem (CID 54163688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).