C29H26N5O5S+ — CID 54163729
5-methoxy-2-[5-(4-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)tetrazol-2-ium-2-yl]benzo[e][1,3]benzothiazole (PubChem CID 54163729) has the molecular formula C29H26N5O5S+ and a molecular weight of 556.62 g/mol. Its IUPAC name is 5-methoxy-2-[5-(4-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)tetrazol-2-ium-2-yl]benzo[e][1,3]benzothiazole.
| Compound Name | 5-methoxy-2-[5-(4-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)tetrazol-2-ium-2-yl]benzo[e][1,3]benzothiazole |
|---|---|
| PubChem CID | 54163729 |
| Molecular Formula | C29H26N5O5S+ |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 5-methoxy-2-[5-(4-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)tetrazol-2-ium-2-yl]benzo[e][1,3]benzothiazole |
| SMILES | COc1ccc(-c2nn(-c3cc(OC)c(OC)c(OC)c3)[n+](-c3nc4c(cc(OC)c5ccccc54)s3)n2)cc1 |
| InChI | InChI=1S/C29H26N5O5S/c1-35-19-12-10-17(11-13-19)28-31-33(18-14-23(37-3)27(39-5)24(15-18)38-4)34(32-28)29-30-26-21-9-7-6-8-20(21)22(36-2)16-25(26)40-29/h6-16H,1-5H3/q+1 |
| InChIKey | OQFCFUWSVONFRX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 93.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|