C26H48N2O4 — CID 54164307
6-oxo-4-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyhexanoic acid (PubChem CID 54164307) has the molecular formula C26H48N2O4 and a molecular weight of 452.68 g/mol. Its IUPAC name is 6-oxo-4-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyhexanoic acid.
| Compound Name | 6-oxo-4-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 54164307 |
| Molecular Formula | C26H48N2O4 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.36 |
| IUPAC Name | 6-oxo-4-(1,2,2,6,6-pentamethylpiperidin-4-yl)-6-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyhexanoic acid |
| SMILES | CN1C(C)(C)CC(OC(=O)CC(CCC(=O)O)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C26H48N2O4/c1-23(2)14-19(15-24(3,4)27(23)9)18(11-12-21(29)30)13-22(31)32-20-16-25(5,6)28(10)26(7,8)17-20/h18-20H,11-17H2,1-10H3,(H,29,30) |
| InChIKey | OQOWJTKHRLXMIG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |