C19H33NO3S2 — CID 54164656
N-hydroxy-N-methyl-5-[[(1S,2S,3R,4R)-3-(pent-3-enylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]pentanamide (PubChem CID 54164656) has the molecular formula C19H33NO3S2 and a molecular weight of 387.61 g/mol. Its IUPAC name is N-hydroxy-N-methyl-5-[[(1S,2S,3R,4R)-3-(pent-3-enylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]pentanamide.
| Compound Name | N-hydroxy-N-methyl-5-[[(1S,2S,3R,4R)-3-(pent-3-enylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]pentanamide |
|---|---|
| PubChem CID | 54164656 |
| Molecular Formula | C19H33NO3S2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-hydroxy-N-methyl-5-[[(1S,2S,3R,4R)-3-(pent-3-enylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]pentanamide |
| SMILES | CC=CCCSC[C@@H]1[C@H](CSCCCCC(=O)N(C)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C19H33NO3S2/c1-3-4-6-11-24-13-15-16(18-10-9-17(15)23-18)14-25-12-7-5-8-19(21)20(2)22/h3-4,15-18,22H,5-14H2,1-2H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | OQUOQRRGRJVSNB-XDNAFOTISA-N |
| XLogP | 4.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|