About 1-buta-1,3-dienyl-2-phenylbenzene
1-buta-1,3-dienyl-2-phenylbenzene (PubChem CID 54164854) has the molecular formula C16H14
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-buta-1,3-dienyl-2-phenylbenzene.
Molecular Properties
| Compound Name | 1-buta-1,3-dienyl-2-phenylbenzene |
| PubChem CID | 54164854 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-buta-1,3-dienyl-2-phenylbenzene |
| SMILES | C=CC=Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C16H14/c1-2-3-9-14-12-7-8-13-16(14)15-10-5-4-6-11-15/h2-13H,1H2 |
| InChIKey | OQXQUGCRXVDTAW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dienyl-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dienyl-2-phenylbenzene?
The IUPAC name of 1-buta-1,3-dienyl-2-phenylbenzene (CID 54164854) is 1-buta-1,3-dienyl-2-phenylbenzene.
What is the SMILES notation for 1-buta-1,3-dienyl-2-phenylbenzene?
The canonical SMILES for 1-buta-1,3-dienyl-2-phenylbenzene is C=CC=Cc1ccccc1-c1ccccc1.
What is the InChIKey of 1-buta-1,3-dienyl-2-phenylbenzene?
The InChIKey is OQXQUGCRXVDTAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14/c1-2-3-9-14-12-7-8-13-16(14)15-10-5-4-6-11-15/h2-13H,1H2.
What are the key properties of 1-buta-1,3-dienyl-2-phenylbenzene?
1-buta-1,3-dienyl-2-phenylbenzene has a molecular weight of 206.29 g/mol, XLogP of 4.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dienyl-2-phenylbenzene is sourced from PubChem (CID 54164854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).