C11H21NO8S — CID 54164950
[(3aS,6R,7R,7aS)-2,2-diethyl-6,7-dihydroxy-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methyl sulfamate (PubChem CID 54164950) has the molecular formula C11H21NO8S and a molecular weight of 327.36 g/mol. Its IUPAC name is [(3aS,6R,7R,7aS)-2,2-diethyl-6,7-dihydroxy-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methyl sulfamate.
| Compound Name | [(3aS,6R,7R,7aS)-2,2-diethyl-6,7-dihydroxy-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methyl sulfamate |
|---|---|
| PubChem CID | 54164950 |
| Molecular Formula | C11H21NO8S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [(3aS,6R,7R,7aS)-2,2-diethyl-6,7-dihydroxy-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyran-3a-yl]methyl sulfamate |
| SMILES | CCC1(CC)O[C@H]2[C@H](O)[C@H](O)CO[C@@]2(COS(N)(=O)=O)O1 |
| InChI | InChI=1S/C11H21NO8S/c1-3-10(4-2)19-9-8(14)7(13)5-17-11(9,20-10)6-18-21(12,15)16/h7-9,13-14H,3-6H2,1-2H3,(H2,12,15,16)/t7-,8-,9+,11+/m1/s1 |
| InChIKey | OQZOYTTWDVWQGV-REIXXSIJSA-N |
| XLogP | -1.41 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |