About 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide
2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide (PubChem CID 54165128) has the molecular formula C18H23N3O3
and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide.
Molecular Properties
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide |
| PubChem CID | 54165128 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccccc1C1CCNCC1)n1c(O)ccc1O |
| InChI | InChI=1S/C18H23N3O3/c1-12(21-16(22)6-7-17(21)23)18(24)20-15-5-3-2-4-14(15)13-8-10-19-11-9-13/h2-7,12-13,19,22-23H,8-11H2,1H3,(H,20,24) |
| InChIKey | ORCYRDZZWGWGSF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide?
The IUPAC name of 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide (CID 54165128) is 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide.
What is the SMILES notation for 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide?
The canonical SMILES for 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide is CC(C(=O)Nc1ccccc1C1CCNCC1)n1c(O)ccc1O.
What is the InChIKey of 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide?
The InChIKey is ORCYRDZZWGWGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c1-12(21-16(22)6-7-17(21)23)18(24)20-15-5-3-2-4-14(15)13-8-10-19-11-9-13/h2-7,12-13,19,22-23H,8-11H2,1H3,(H,20,24).
What are the key properties of 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide?
2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide has a molecular weight of 329.40 g/mol, XLogP of 2.57, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydroxypyrrol-1-yl)-N-(2-piperidin-4-ylphenyl)propanamide is sourced from PubChem (CID 54165128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).