C27H38N2O18S2 — CID 54165315
7,9-bis[carboxy-(2,5-dihydroxypyrrol-1-yl)-sulfomethyl]pentadecanedioic acid (PubChem CID 54165315) has the molecular formula C27H38N2O18S2 and a molecular weight of 742.73 g/mol. Its IUPAC name is 7,9-bis[carboxy-(2,5-dihydroxypyrrol-1-yl)-sulfomethyl]pentadecanedioic acid.
| Compound Name | 7,9-bis[carboxy-(2,5-dihydroxypyrrol-1-yl)-sulfomethyl]pentadecanedioic acid |
|---|---|
| PubChem CID | 54165315 |
| Molecular Formula | C27H38N2O18S2 |
| Molecular Weight | 742.73 g/mol |
| Exact Mass | 742.16 |
| IUPAC Name | 7,9-bis[carboxy-(2,5-dihydroxypyrrol-1-yl)-sulfomethyl]pentadecanedioic acid |
| SMILES | O=C(O)CCCCCC(CC(CCCCCC(=O)O)C(C(=O)O)(n1c(O)ccc1O)S(=O)(=O)O)C(C(=O)O)(n1c(O)ccc1O)S(=O)(=O)O |
| InChI | InChI=1S/C27H38N2O18S2/c30-18-11-12-19(31)28(18)26(24(38)39,48(42,43)44)16(7-3-1-5-9-22(34)35)15-17(8-4-2-6-10-23(36)37)27(25(40)41,49(45,46)47)29-20(32)13-14-21(29)33/h11-14,16-17,30-33H,1-10,15H2,(H,34,35)(H,36,37)(H,38,39)(H,40,41)(H,42,43,44)(H,45,46,47) |
| InChIKey | ORGCFDSDDMGHHV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 348.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|