C29H39N5O7S — CID 54165474
(2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]acetyl]amino]-4-phenylbutanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 54165474) has the molecular formula C29H39N5O7S and a molecular weight of 601.73 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]acetyl]amino]-4-phenylbutanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]acetyl]amino]-4-phenylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 54165474 |
| Molecular Formula | C29H39N5O7S |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]acetyl]amino]-4-phenylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCc1ccccc1)NC(=O)CNC(=O)[C@@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C29H39N5O7S/c1-18(32-27(38)22(30)16-20-8-11-21(35)12-9-20)26(37)31-17-25(36)33-23(13-10-19-6-4-3-5-7-19)28(39)34-24(29(40)41)14-15-42-2/h3-9,11-12,18,22-24,35H,10,13-17,30H2,1-2H3,(H,31,37)(H,32,38)(H,33,36)(H,34,39)(H,40,41)/t18-,22+,23+,24+/m1/s1 |
| InChIKey | ORIUBDNXIFHSNV-JMBSJVKXSA-N |
| XLogP | 0.32 |
| TPSA | 199.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |