About 3-cyclohexyl-1H-pyrrole-2,5-diol
3-cyclohexyl-1H-pyrrole-2,5-diol (PubChem CID 54165488) has the molecular formula C10H15NO2
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-cyclohexyl-1H-pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-cyclohexyl-1H-pyrrole-2,5-diol |
| PubChem CID | 54165488 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-cyclohexyl-1H-pyrrole-2,5-diol |
| SMILES | Oc1cc(C2CCCCC2)c(O)[nH]1 |
| InChI | InChI=1S/C10H15NO2/c12-9-6-8(10(13)11-9)7-4-2-1-3-5-7/h6-7,11-13H,1-5H2 |
| InChIKey | ORIZJPJJIYVMBF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexyl-1H-pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1H-pyrrole-2,5-diol?
The IUPAC name of 3-cyclohexyl-1H-pyrrole-2,5-diol (CID 54165488) is 3-cyclohexyl-1H-pyrrole-2,5-diol.
What is the SMILES notation for 3-cyclohexyl-1H-pyrrole-2,5-diol?
The canonical SMILES for 3-cyclohexyl-1H-pyrrole-2,5-diol is Oc1cc(C2CCCCC2)c(O)[nH]1.
What is the InChIKey of 3-cyclohexyl-1H-pyrrole-2,5-diol?
The InChIKey is ORIZJPJJIYVMBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c12-9-6-8(10(13)11-9)7-4-2-1-3-5-7/h6-7,11-13H,1-5H2.
What are the key properties of 3-cyclohexyl-1H-pyrrole-2,5-diol?
3-cyclohexyl-1H-pyrrole-2,5-diol has a molecular weight of 181.24 g/mol, XLogP of 2.47, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1H-pyrrole-2,5-diol is sourced from PubChem (CID 54165488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).