C17H24N6O7 — CID 54165696
4-ethyl-N-[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-oxopropyl]-2,3-dioxopiperazine-1-carboxamide (PubChem CID 54165696) has the molecular formula C17H24N6O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is 4-ethyl-N-[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-oxopropyl]-2,3-dioxopiperazine-1-carboxamide.
| Compound Name | 4-ethyl-N-[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-oxopropyl]-2,3-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 54165696 |
| Molecular Formula | C17H24N6O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 4-ethyl-N-[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-oxopropyl]-2,3-dioxopiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NCC(C=O)NC(=O)N2CCN(CC)C(=O)C2=O)C(=O)C1=O |
| InChI | InChI=1S/C17H24N6O7/c1-3-20-5-7-22(14(27)12(20)25)16(29)18-9-11(10-24)19-17(30)23-8-6-21(4-2)13(26)15(23)28/h10-11H,3-9H2,1-2H3,(H,18,29)(H,19,30) |
| InChIKey | IQLYVKPZPDKMOC-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 156.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|