About ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate
ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 54165733) has the molecular formula C21H25FN2O2
and a molecular weight of 356.44 g/mol. Its IUPAC name is ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate |
| PubChem CID | 54165733 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1C(C(C)C)=NC(c2ccc(F)cc2)=C(C#N)C1C(C)C |
| InChI | InChI=1S/C21H25FN2O2/c1-6-26-21(25)18-17(12(2)3)16(11-23)20(24-19(18)13(4)5)14-7-9-15(22)10-8-14/h7-10,12-13,17-18H,6H2,1-5H3 |
| InChIKey | ORNBSBGBGLFFLV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate?
The IUPAC name of ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate (CID 54165733) is ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate.
What is the SMILES notation for ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate?
The canonical SMILES for ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate is CCOC(=O)C1C(C(C)C)=NC(c2ccc(F)cc2)=C(C#N)C1C(C)C.
What is the InChIKey of ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate?
The InChIKey is ORNBSBGBGLFFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25FN2O2/c1-6-26-21(25)18-17(12(2)3)16(11-23)20(24-19(18)13(4)5)14-7-9-15(22)10-8-14/h7-10,12-13,17-18H,6H2,1-5H3.
What are the key properties of ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate?
ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate has a molecular weight of 356.44 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-cyano-6-(4-fluorophenyl)-2,4-di(propan-2-yl)-3,4-dihydropyridine-3-carboxylate is sourced from PubChem (CID 54165733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).