About 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane
1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane (PubChem CID 54165833) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane.
Molecular Properties
| Compound Name | 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane |
| PubChem CID | 54165833 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane |
| SMILES | CC.CC.O=C1OCc2ccccc2N1C1CCCCC1 |
| InChI | InChI=1S/C14H17NO2.2C2H6/c16-14-15(12-7-2-1-3-8-12)13-9-5-4-6-11(13)10-17-14;2*1-2/h4-6,9,12H,1-3,7-8,10H2;2*1-2H3 |
| InChIKey | OROKNJOEHWVUAR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane?
The IUPAC name of 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane (CID 54165833) is 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane.
What is the SMILES notation for 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane?
The canonical SMILES for 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane is CC.CC.O=C1OCc2ccccc2N1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane?
The InChIKey is OROKNJOEHWVUAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2.2C2H6/c16-14-15(12-7-2-1-3-8-12)13-9-5-4-6-11(13)10-17-14;2*1-2/h4-6,9,12H,1-3,7-8,10H2;2*1-2H3.
What are the key properties of 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane?
1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane has a molecular weight of 291.44 g/mol, XLogP of 5.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4H-3,1-benzoxazin-2-one;ethane is sourced from PubChem (CID 54165833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).