C38H54O5 — CID 54165913
methyl 3,7,11-trimethyl-2-[2-(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)acetyl]dodec-4-enoate (PubChem CID 54165913) has the molecular formula C38H54O5 and a molecular weight of 590.85 g/mol. Its IUPAC name is methyl 3,7,11-trimethyl-2-[2-(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)acetyl]dodec-4-enoate.
| Compound Name | methyl 3,7,11-trimethyl-2-[2-(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)acetyl]dodec-4-enoate |
|---|---|
| PubChem CID | 54165913 |
| Molecular Formula | C38H54O5 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | methyl 3,7,11-trimethyl-2-[2-(2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromen-2-yl)acetyl]dodec-4-enoate |
| SMILES | COC(=O)C(C(=O)CC1(C)CCc2c(C)c(OCc3ccccc3)c(C)c(C)c2O1)C(C)C=CCC(C)CCCC(C)C |
| InChI | InChI=1S/C38H54O5/c1-25(2)15-13-16-26(3)17-14-18-27(4)34(37(40)41-9)33(39)23-38(8)22-21-32-30(7)35(28(5)29(6)36(32)43-38)42-24-31-19-11-10-12-20-31/h10-12,14,18-20,25-27,34H,13,15-17,21-24H2,1-9H3 |
| InChIKey | ORPMVBOCMBNBAX-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|