C20H44N2 — CID 54165968
2,2,12-triethyltetradecane-1,11-diamine (PubChem CID 54165968) has the molecular formula C20H44N2 and a molecular weight of 312.59 g/mol. Its IUPAC name is 2,2,12-triethyltetradecane-1,11-diamine.
| Compound Name | 2,2,12-triethyltetradecane-1,11-diamine |
|---|---|
| PubChem CID | 54165968 |
| Molecular Formula | C20H44N2 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 312.35 |
| IUPAC Name | 2,2,12-triethyltetradecane-1,11-diamine |
| SMILES | CCC(CC)C(N)CCCCCCCCC(CC)(CC)CN |
| InChI | InChI=1S/C20H44N2/c1-5-18(6-2)19(22)15-13-11-9-10-12-14-16-20(7-3,8-4)17-21/h18-19H,5-17,21-22H2,1-4H3 |
| InChIKey | ORQORZZIDRCLDN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|