About N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine
N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine (PubChem CID 54166151) has the molecular formula C13H20BrN
and a molecular weight of 273.23 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine |
| PubChem CID | 54166151 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine |
| SMILES | [2H]CC([2H])(Cc1ccc(Br)cc1)N([2H])CC(C)C |
| InChI | InChI=1S/C13H20BrN/c1-10(2)9-15-11(3)8-12-4-6-13(14)7-5-12/h4-7,10-11,15H,8-9H2,1-3H3/i3D,11D/hD |
| InChIKey | ORTTUBVLAPBISW-WFKOMSBXSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine?
The IUPAC name of N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine (CID 54166151) is N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine.
What is the SMILES notation for N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine?
The canonical SMILES for N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine is [2H]CC([2H])(Cc1ccc(Br)cc1)N([2H])CC(C)C.
What is the InChIKey of N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine?
The InChIKey is ORTTUBVLAPBISW-WFKOMSBXSA-N. The full InChI is InChI=1S/C13H20BrN/c1-10(2)9-15-11(3)8-12-4-6-13(14)7-5-12/h4-7,10-11,15H,8-9H2,1-3H3/i3D,11D/hD.
What are the key properties of N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine?
N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine has a molecular weight of 273.23 g/mol, XLogP of 3.63, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-bromophenyl)-2,3-dideuteriopropan-2-yl]-N-deuterio-2-methylpropan-1-amine is sourced from PubChem (CID 54166151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).