C13H17N3O4 — CID 54166305
5-amino-3-(2-nitro-1-phenylethyl)-2,3,6,7-tetrahydro-1,4-oxazepin-6-ol (PubChem CID 54166305) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-amino-3-(2-nitro-1-phenylethyl)-2,3,6,7-tetrahydro-1,4-oxazepin-6-ol.
| Compound Name | 5-amino-3-(2-nitro-1-phenylethyl)-2,3,6,7-tetrahydro-1,4-oxazepin-6-ol |
|---|---|
| PubChem CID | 54166305 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-amino-3-(2-nitro-1-phenylethyl)-2,3,6,7-tetrahydro-1,4-oxazepin-6-ol |
| SMILES | NC1=NC(C(C[N+](=O)[O-])c2ccccc2)COCC1O |
| InChI | InChI=1S/C13H17N3O4/c14-13-12(17)8-20-7-11(15-13)10(6-16(18)19)9-4-2-1-3-5-9/h1-5,10-12,17H,6-8H2,(H2,14,15) |
| InChIKey | ORWKQHAZSRMSNT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|