C42H35Cl2N8+ — CID 54166416
4-[3,4-bis[2-(6-chloro-1H-indol-3-yl)ethyl]-1-(3-cyano-1H-indol-4-yl)piperazin-1-ium-1-yl]-1H-indole-3-carbonitrile (PubChem CID 54166416) has the molecular formula C42H35Cl2N8+ and a molecular weight of 722.70 g/mol. Its IUPAC name is 4-[3,4-bis[2-(6-chloro-1H-indol-3-yl)ethyl]-1-(3-cyano-1H-indol-4-yl)piperazin-1-ium-1-yl]-1H-indole-3-carbonitrile.
| Compound Name | 4-[3,4-bis[2-(6-chloro-1H-indol-3-yl)ethyl]-1-(3-cyano-1H-indol-4-yl)piperazin-1-ium-1-yl]-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 54166416 |
| Molecular Formula | C42H35Cl2N8+ |
| Molecular Weight | 722.70 g/mol |
| Exact Mass | 721.24 |
| IUPAC Name | 4-[3,4-bis[2-(6-chloro-1H-indol-3-yl)ethyl]-1-(3-cyano-1H-indol-4-yl)piperazin-1-ium-1-yl]-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2cccc([N+]3(c4cccc5[nH]cc(C#N)c45)CCN(CCc4c[nH]c5cc(Cl)ccc45)C(CCc4c[nH]c5cc(Cl)ccc45)C3)c12 |
| InChI | InChI=1S/C42H35Cl2N8/c43-30-8-11-33-26(21-49-37(33)17-30)7-10-32-25-52(39-5-1-3-35-41(39)28(19-45)23-47-35,40-6-2-4-36-42(40)29(20-46)24-48-36)16-15-51(32)14-13-27-22-50-38-18-31(44)9-12-34(27)38/h1-6,8-9,11-12,17-18,21-24,32,47-50H,7,10,13-16,25H2/q+1 |
| InChIKey | ZICSCUZPFJHMMJ-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.70 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|