C15H12F2N4O5S2 — CID 54166442
methyl 7-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2,2-difluoro-[1,3]dioxolo[4,5-f]benzimidazole-6-carboximidothioate (PubChem CID 54166442) has the molecular formula C15H12F2N4O5S2 and a molecular weight of 430.41 g/mol. Its IUPAC name is methyl 7-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2,2-difluoro-[1,3]dioxolo[4,5-f]benzimidazole-6-carboximidothioate.
| Compound Name | methyl 7-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2,2-difluoro-[1,3]dioxolo[4,5-f]benzimidazole-6-carboximidothioate |
|---|---|
| PubChem CID | 54166442 |
| Molecular Formula | C15H12F2N4O5S2 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | methyl 7-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-2,2-difluoro-[1,3]dioxolo[4,5-f]benzimidazole-6-carboximidothioate |
| SMILES | [H]/N=C(\SC)c1nc2cc3c(cc2n1S(=O)(=O)c1c(C)noc1C)OC(F)(F)O3 |
| InChI | InChI=1S/C15H12F2N4O5S2/c1-6-12(7(2)26-20-6)28(22,23)21-9-5-11-10(24-15(16,17)25-11)4-8(9)19-14(21)13(18)27-3/h4-5,18H,1-3H3/b18-13- |
| InChIKey | ORZAKMOKGCRGOA-AQTBWJFISA-N |
| XLogP | 2.89 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|