C22H17NO5 — CID 54166579
7-amino-3',6'-dihydroxy-4',5'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 54166579) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is 7-amino-3',6'-dihydroxy-4',5'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 7-amino-3',6'-dihydroxy-4',5'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 54166579 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 7-amino-3',6'-dihydroxy-4',5'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Cc1c(O)ccc2c1Oc1c(ccc(O)c1C)C21OC(=O)c2c(N)cccc21 |
| InChI | InChI=1S/C22H17NO5/c1-10-16(24)8-6-13-19(10)27-20-11(2)17(25)9-7-14(20)22(13)12-4-3-5-15(23)18(12)21(26)28-22/h3-9,24-25H,23H2,1-2H3 |
| InChIKey | OSBBXWMJKCUOSC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|