About 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol
4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol (PubChem CID 54167103) has the molecular formula C18H19NO2S
and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol.
Molecular Properties
| Compound Name | 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol |
| PubChem CID | 54167103 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol |
| SMILES | CCc1ccc(N(C)c2coc(-c3cccs3)c2O)cc1C |
| InChI | InChI=1S/C18H19NO2S/c1-4-13-7-8-14(10-12(13)2)19(3)15-11-21-18(17(15)20)16-6-5-9-22-16/h5-11,20H,4H2,1-3H3 |
| InChIKey | OSKMEYYYRNRBCK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol?
The IUPAC name of 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol (CID 54167103) is 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol.
What is the SMILES notation for 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol?
The canonical SMILES for 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol is CCc1ccc(N(C)c2coc(-c3cccs3)c2O)cc1C.
What is the InChIKey of 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol?
The InChIKey is OSKMEYYYRNRBCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2S/c1-4-13-7-8-14(10-12(13)2)19(3)15-11-21-18(17(15)20)16-6-5-9-22-16/h5-11,20H,4H2,1-3H3.
What are the key properties of 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol?
4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol has a molecular weight of 313.42 g/mol, XLogP of 5.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethyl-N,3-dimethylanilino)-2-thiophen-2-ylfuran-3-ol is sourced from PubChem (CID 54167103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).