About [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate
[3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate (PubChem CID 54167133) has the molecular formula C21H25ClO4
and a molecular weight of 376.88 g/mol. Its IUPAC name is [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate |
| PubChem CID | 54167133 |
| Molecular Formula | C21H25ClO4 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCCC(C)(O)c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H25ClO4/c1-15(2)14-20(23)25-13-12-21(3,24)16-4-8-18(9-5-16)26-19-10-6-17(22)7-11-19/h4-11,15,24H,12-14H2,1-3H3 |
| InChIKey | OSLBVCFELPFBLN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate?
The IUPAC name of [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate (CID 54167133) is [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate.
What is the SMILES notation for [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate?
The canonical SMILES for [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate is CC(C)CC(=O)OCCC(C)(O)c1ccc(Oc2ccc(Cl)cc2)cc1.
What is the InChIKey of [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate?
The InChIKey is OSLBVCFELPFBLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25ClO4/c1-15(2)14-20(23)25-13-12-21(3,24)16-4-8-18(9-5-16)26-19-10-6-17(22)7-11-19/h4-11,15,24H,12-14H2,1-3H3.
What are the key properties of [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate?
[3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate has a molecular weight of 376.88 g/mol, XLogP of 5.32, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-(4-chlorophenoxy)phenyl]-3-hydroxybutyl] 3-methylbutanoate is sourced from PubChem (CID 54167133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).