C10H7F13 — CID 54167413
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnon-1-ene (PubChem CID 54167413) has the molecular formula C10H7F13 and a molecular weight of 374.14 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnon-1-ene.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnon-1-ene |
|---|---|
| PubChem CID | 54167413 |
| Molecular Formula | C10H7F13 |
| Molecular Weight | 374.14 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnon-1-ene |
| SMILES | C=CC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F13/c1-3-4(2)5(11,12)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h3-4H,1H2,2H3 |
| InChIKey | QGHFXRZGQMKNKT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.14 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|