C16H30N2O — CID 54167766
N-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)but-2-enamide (PubChem CID 54167766) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is N-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)but-2-enamide.
| Compound Name | N-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)but-2-enamide |
|---|---|
| PubChem CID | 54167766 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | N-(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl)but-2-enamide |
| SMILES | CC=CC(=O)NC1CC(C)(CC)NC(C)(CC)C1C |
| InChI | InChI=1S/C16H30N2O/c1-7-10-14(19)17-13-11-15(5,8-2)18-16(6,9-3)12(13)4/h7,10,12-13,18H,8-9,11H2,1-6H3,(H,17,19) |
| InChIKey | OSVPWCTYSNTROU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|