C21H18F3NO5 — CID 54167798
methyl 2-[2-[N-acetyloxy-C-[3-(trifluoromethyl)phenyl]carbonimidoyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 54167798) has the molecular formula C21H18F3NO5 and a molecular weight of 421.37 g/mol. Its IUPAC name is methyl 2-[2-[N-acetyloxy-C-[3-(trifluoromethyl)phenyl]carbonimidoyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl 2-[2-[N-acetyloxy-C-[3-(trifluoromethyl)phenyl]carbonimidoyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 54167798 |
| Molecular Formula | C21H18F3NO5 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | methyl 2-[2-[N-acetyloxy-C-[3-(trifluoromethyl)phenyl]carbonimidoyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | COC=C(C(=O)OC)c1ccccc1C(=NOC(C)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3NO5/c1-13(26)30-25-19(14-7-6-8-15(11-14)21(22,23)24)17-10-5-4-9-16(17)18(12-28-2)20(27)29-3/h4-12H,1-3H3 |
| InChIKey | OSWKCBUJPHAGSG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|