C17H36O6Si2 — CID 54168114
(6aR,9R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine-8,9-diol (PubChem CID 54168114) has the molecular formula C17H36O6Si2 and a molecular weight of 392.64 g/mol. Its IUPAC name is (6aR,9R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine-8,9-diol.
| Compound Name | (6aR,9R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine-8,9-diol |
|---|---|
| PubChem CID | 54168114 |
| Molecular Formula | C17H36O6Si2 |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (6aR,9R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine-8,9-diol |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2OC(O)[C@H](O)[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C17H36O6Si2/c1-10(2)24(11(3)4)20-9-14-16(15(18)17(19)21-14)22-25(23-24,12(5)6)13(7)8/h10-19H,9H2,1-8H3/t14-,15-,16-,17?/m1/s1 |
| InChIKey | OTBJUQSUURVDRL-HJNZIYBASA-N |
| XLogP | 3.02 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|