C12H12Cl2 — CID 54168823
(2S,5S)-5-(1,2-dichloroethenyl)tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 54168823) has the molecular formula C12H12Cl2 and a molecular weight of 227.13 g/mol. Its IUPAC name is (2S,5S)-5-(1,2-dichloroethenyl)tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (2S,5S)-5-(1,2-dichloroethenyl)tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 54168823 |
| Molecular Formula | C12H12Cl2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | (2S,5S)-5-(1,2-dichloroethenyl)tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | ClC=C(Cl)C1C=C[C@H]2C3C=CC(C3)C12 |
| InChI | InChI=1S/C12H12Cl2/c13-6-11(14)10-4-3-9-7-1-2-8(5-7)12(9)10/h1-4,6-10,12H,5H2/t7?,8?,9-,10?,12?/m0/s1 |
| InChIKey | OTOOSVNPHWOGIO-QHFZNNSSSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|