C25H31NO3 — CID 54169457
6-(2,2-dihydroxyethyl)-2-[2-(4-phenylpiperidin-1-yl)ethyl]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 54169457) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 6-(2,2-dihydroxyethyl)-2-[2-(4-phenylpiperidin-1-yl)ethyl]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-(2,2-dihydroxyethyl)-2-[2-(4-phenylpiperidin-1-yl)ethyl]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 54169457 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 6-(2,2-dihydroxyethyl)-2-[2-(4-phenylpiperidin-1-yl)ethyl]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccc(CC(O)O)cc2CCC1CCN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H31NO3/c27-24(28)17-18-6-9-23-22(16-18)8-7-21(25(23)29)12-15-26-13-10-20(11-14-26)19-4-2-1-3-5-19/h1-6,9,16,20-21,24,27-28H,7-8,10-15,17H2 |
| InChIKey | OTZCTMASXQHVFA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|