C26H41N3O4S — CID 54170067
methyl N-[(2R)-4-[3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]carbamate (PubChem CID 54170067) has the molecular formula C26H41N3O4S and a molecular weight of 491.70 g/mol. Its IUPAC name is methyl N-[(2R)-4-[3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]carbamate.
| Compound Name | methyl N-[(2R)-4-[3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 54170067 |
| Molecular Formula | C26H41N3O4S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | methyl N-[(2R)-4-[3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](CSc1ccccc1)C(O)CN1CC2CCCCC2CC1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C26H41N3O4S/c1-26(2,3)28-24(31)22-14-18-10-8-9-11-19(18)15-29(22)16-23(30)21(27-25(32)33-4)17-34-20-12-6-5-7-13-20/h5-7,12-13,18-19,21-23,30H,8-11,14-17H2,1-4H3,(H,27,32)(H,28,31)/t18?,19?,21-,22?,23?/m0/s1 |
| InChIKey | OUJOQTCNZNJVOM-DXYAOYNESA-N |
| XLogP | 3.66 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |