C24H40N4O3 — CID 54170141
2-[1-[(4-butylphenyl)carbamoyl]piperidin-2-yl]ethyl N-[3-(dimethylamino)propyl]carbamate (PubChem CID 54170141) has the molecular formula C24H40N4O3 and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-[1-[(4-butylphenyl)carbamoyl]piperidin-2-yl]ethyl N-[3-(dimethylamino)propyl]carbamate.
| Compound Name | 2-[1-[(4-butylphenyl)carbamoyl]piperidin-2-yl]ethyl N-[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 54170141 |
| Molecular Formula | C24H40N4O3 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | 2-[1-[(4-butylphenyl)carbamoyl]piperidin-2-yl]ethyl N-[3-(dimethylamino)propyl]carbamate |
| SMILES | CCCCc1ccc(NC(=O)N2CCCCC2CCOC(=O)NCCCN(C)C)cc1 |
| InChI | InChI=1S/C24H40N4O3/c1-4-5-9-20-11-13-21(14-12-20)26-23(29)28-18-7-6-10-22(28)15-19-31-24(30)25-16-8-17-27(2)3/h11-14,22H,4-10,15-19H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | OUKYFAMDCNTRRY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|