C18H18ClN7 — CID 54170912
10-(2-aminoethyl)-7-N-(2-chloro-6-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine (PubChem CID 54170912) has the molecular formula C18H18ClN7 and a molecular weight of 367.84 g/mol. Its IUPAC name is 10-(2-aminoethyl)-7-N-(2-chloro-6-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine.
| Compound Name | 10-(2-aminoethyl)-7-N-(2-chloro-6-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine |
|---|---|
| PubChem CID | 54170912 |
| Molecular Formula | C18H18ClN7 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 10-(2-aminoethyl)-7-N-(2-chloro-6-methylphenyl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7,12-diamine |
| SMILES | Cc1cccc(Cl)c1Nc1nc2c(CCN)cc(N)nc2n2cncc12 |
| InChI | InChI=1S/C18H18ClN7/c1-10-3-2-4-12(19)15(10)24-17-13-8-22-9-26(13)18-16(25-17)11(5-6-20)7-14(21)23-18/h2-4,7-9H,5-6,20H2,1H3,(H2,21,23)(H,24,25) |
| InChIKey | OUYPORACESCRAJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |