C6H7F8NO — CID 541711
1,1,3,3,3-pentafluoro-N-methoxy-N-methyl-2-(trifluoromethyl)propan-1-amine (PubChem CID 541711) has the molecular formula C6H7F8NO and a molecular weight of 261.11 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-N-methoxy-N-methyl-2-(trifluoromethyl)propan-1-amine.
| Compound Name | 1,1,3,3,3-pentafluoro-N-methoxy-N-methyl-2-(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 541711 |
| Molecular Formula | C6H7F8NO |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-N-methoxy-N-methyl-2-(trifluoromethyl)propan-1-amine |
| SMILES | CON(C)C(F)(F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F8NO/c1-15(16-2)6(13,14)3(4(7,8)9)5(10,11)12/h3H,1-2H3 |
| InChIKey | OYLJZOHEISBXJX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|