About 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one
4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one (PubChem CID 54171261) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one.
Molecular Properties
| Compound Name | 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one |
| PubChem CID | 54171261 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one |
| SMILES | O=C1OCC2C3CC=C(C3)C12 |
| InChI | InChI=1S/C9H10O2/c10-9-8-6-2-1-5(3-6)7(8)4-11-9/h2,5,7-8H,1,3-4H2 |
| InChIKey | OVEYUSLXYNLLMA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one?
The IUPAC name of 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one (CID 54171261) is 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one.
What is the SMILES notation for 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one?
The canonical SMILES for 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one is O=C1OCC2C3CC=C(C3)C12.
What is the InChIKey of 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one?
The InChIKey is OVEYUSLXYNLLMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c10-9-8-6-2-1-5(3-6)7(8)4-11-9/h2,5,7-8H,1,3-4H2.
What are the key properties of 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one?
4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one has a molecular weight of 150.18 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxatricyclo[5.2.1.02,6]dec-1(9)-en-3-one is sourced from PubChem (CID 54171261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).