About 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane
2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane (PubChem CID 54171414) has the molecular formula C9H24N2O3
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane |
| PubChem CID | 54171414 |
| Molecular Formula | C9H24N2O3 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane |
| SMILES | C1CO1.CN(C)CCO.CNCCO |
| InChI | InChI=1S/C4H11NO.C3H9NO.C2H4O/c1-5(2)3-4-6;1-4-2-3-5;1-2-3-1/h6H,3-4H2,1-2H3;4-5H,2-3H2,1H3;1-2H2 |
| InChIKey | OVHKRZHVNUXSMJ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane?
The IUPAC name of 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane (CID 54171414) is 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane.
What is the SMILES notation for 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane?
The canonical SMILES for 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane is C1CO1.CN(C)CCO.CNCCO.
What is the InChIKey of 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane?
The InChIKey is OVHKRZHVNUXSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO.C3H9NO.C2H4O/c1-5(2)3-4-6;1-4-2-3-5;1-2-3-1/h6H,3-4H2,1-2H3;4-5H,2-3H2,1H3;1-2H2.
What are the key properties of 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane?
2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane has a molecular weight of 208.30 g/mol, XLogP of -1.25, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethanol;2-(methylamino)ethanol;oxirane is sourced from PubChem (CID 54171414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).