C15H18O6 — CID 54172043
3-[3,4-dihydroxy-3,4-di(propanoyl)cyclohexa-1,5-dien-1-yl]prop-2-enoic acid (PubChem CID 54172043) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is 3-[3,4-dihydroxy-3,4-di(propanoyl)cyclohexa-1,5-dien-1-yl]prop-2-enoic acid.
| Compound Name | 3-[3,4-dihydroxy-3,4-di(propanoyl)cyclohexa-1,5-dien-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54172043 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-[3,4-dihydroxy-3,4-di(propanoyl)cyclohexa-1,5-dien-1-yl]prop-2-enoic acid |
| SMILES | CCC(=O)C1(O)C=CC(C=CC(=O)O)=CC1(O)C(=O)CC |
| InChI | InChI=1S/C15H18O6/c1-3-11(16)14(20)8-7-10(5-6-13(18)19)9-15(14,21)12(17)4-2/h5-9,20-21H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | OVRUMYXBLAQXFY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|