C24H31N3O5 — CID 54172501
tert-butyl 2-[4-[[4-(2-hydroxyethoxy)phenyl]carbamoyl]phenyl]piperazine-1-carboxylate (PubChem CID 54172501) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is tert-butyl 2-[4-[[4-(2-hydroxyethoxy)phenyl]carbamoyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-[[4-(2-hydroxyethoxy)phenyl]carbamoyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54172501 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | tert-butyl 2-[4-[[4-(2-hydroxyethoxy)phenyl]carbamoyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1c1ccc(C(=O)Nc2ccc(OCCO)cc2)cc1 |
| InChI | InChI=1S/C24H31N3O5/c1-24(2,3)32-23(30)27-13-12-25-16-21(27)17-4-6-18(7-5-17)22(29)26-19-8-10-20(11-9-19)31-15-14-28/h4-11,21,25,28H,12-16H2,1-3H3,(H,26,29) |
| InChIKey | OVZVJIPZPRZWJI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |