C15H27N — CID 54172537
(2S)-2-[(4aS,5S,8aS)-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]propan-1-amine (PubChem CID 54172537) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (2S)-2-[(4aS,5S,8aS)-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]propan-1-amine.
| Compound Name | (2S)-2-[(4aS,5S,8aS)-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 54172537 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (2S)-2-[(4aS,5S,8aS)-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]propan-1-amine |
| SMILES | C[C@H](CN)C1=CCC[C@H]2[C@@H](C)CCC[C@]12C |
| InChI | InChI=1S/C15H27N/c1-11-6-5-9-15(3)13(11)7-4-8-14(15)12(2)10-16/h8,11-13H,4-7,9-10,16H2,1-3H3/t11-,12+,13-,15-/m0/s1 |
| InChIKey | OWAPZGWSJBKOCK-XFMPKHEZSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|