C20H36O3 — CID 54172767
trans-(1R,3R)-5-[(7R)-11-hydroxy-7,11-dimethyldodec-2-enylidene]cyclohexane-1,3-diol (PubChem CID 54172767) has the molecular formula C20H36O3 and a molecular weight of 324.50 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(7R)-11-hydroxy-7,11-dimethyldodec-2-enylidene]cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(7R)-11-hydroxy-7,11-dimethyldodec-2-enylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 54172767 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | trans-(1R,3R)-5-[(7R)-11-hydroxy-7,11-dimethyldodec-2-enylidene]cyclohexane-1,3-diol |
| SMILES | C[C@H](CCCC=CC=C1C[C@@H](O)C[C@H](O)C1)CCCC(C)(C)O |
| InChI | InChI=1S/C20H36O3/c1-16(10-8-12-20(2,3)23)9-6-4-5-7-11-17-13-18(21)15-19(22)14-17/h5,7,11,16,18-19,21-23H,4,6,8-10,12-15H2,1-3H3/t16-,18-,19-/m1/s1 |
| InChIKey | OWEIAXJBOMOZJN-BHIYHBOVSA-N |
| XLogP | 4.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|